C21H31BrO — CID 143183595
(5E)-5-[(2R)-2-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propylidene]-2,2-dimethylcyclopentan-1-one (PubChem CID 143183595) has the molecular formula C21H31BrO and a molecular weight of 379.38 g/mol. Its IUPAC name is (5E)-5-[(2R)-2-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propylidene]-2,2-dimethylcyclopentan-1-one.
| Compound Name | (5E)-5-[(2R)-2-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propylidene]-2,2-dimethylcyclopentan-1-one |
|---|---|
| PubChem CID | 143183595 |
| Molecular Formula | C21H31BrO |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | (5E)-5-[(2R)-2-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propylidene]-2,2-dimethylcyclopentan-1-one |
| SMILES | C[C@H](/C=C1\CCC(C)(C)C1=O)[C@H]1CC[C@H]2/C(=C/Br)CCC[C@]12C |
| InChI | InChI=1S/C21H31BrO/c1-14(12-15-9-11-20(2,3)19(15)23)17-7-8-18-16(13-22)6-5-10-21(17,18)4/h12-14,17-18H,5-11H2,1-4H3/b15-12+,16-13+/t14-,17-,18+,21-/m1/s1 |
| InChIKey | XPDBZZPWNWRKFA-RSQANESOSA-N |
| XLogP | 6.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|