C16H21NO — CID 143217656
ethane;1-ethynyl-7-methoxy-N-methyl-3,4-dihydronaphthalen-2-amine (PubChem CID 143217656) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is ethane;1-ethynyl-7-methoxy-N-methyl-3,4-dihydronaphthalen-2-amine.
| Compound Name | ethane;1-ethynyl-7-methoxy-N-methyl-3,4-dihydronaphthalen-2-amine |
|---|---|
| PubChem CID | 143217656 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | ethane;1-ethynyl-7-methoxy-N-methyl-3,4-dihydronaphthalen-2-amine |
| SMILES | C#CC1=C(NC)CCc2ccc(OC)cc21.CC |
| InChI | InChI=1S/C14H15NO.C2H6/c1-4-12-13-9-11(16-3)7-5-10(13)6-8-14(12)15-2;1-2/h1,5,7,9,15H,6,8H2,2-3H3;1-2H3 |
| InChIKey | JMPMXMIWRVAJHE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|