C21H42N4 — CID 143221297
N-[(3-amino-4-iminocyclohexa-1,5-dien-1-yl)methyl]-1-propylpiperidin-4-amine;propane (PubChem CID 143221297) has the molecular formula C21H42N4 and a molecular weight of 350.60 g/mol. Its IUPAC name is N-[(3-amino-4-iminocyclohexa-1,5-dien-1-yl)methyl]-1-propylpiperidin-4-amine;propane.
| Compound Name | N-[(3-amino-4-iminocyclohexa-1,5-dien-1-yl)methyl]-1-propylpiperidin-4-amine;propane |
|---|---|
| PubChem CID | 143221297 |
| Molecular Formula | C21H42N4 |
| Molecular Weight | 350.60 g/mol |
| Exact Mass | 350.34 |
| IUPAC Name | N-[(3-amino-4-iminocyclohexa-1,5-dien-1-yl)methyl]-1-propylpiperidin-4-amine;propane |
| SMILES | CCC.CCC.[H]/N=C1\C=CC(CNC2CCN(CCC)CC2)=CC1N |
| InChI | InChI=1S/C15H26N4.2C3H8/c1-2-7-19-8-5-13(6-9-19)18-11-12-3-4-14(16)15(17)10-12;2*1-3-2/h3-4,10,13,15-16,18H,2,5-9,11,17H2,1H3;2*3H2,1-2H3/b16-14+;; |
| InChIKey | SSJDSAHCYUEZDY-UPONXUSQSA-N |
| XLogP | 4.13 |
| TPSA | 65.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.60 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|