C27H28N2O — CID 143237401
N-[(1E,3E,5Z)-1-[4-(4-methylanilino)phenyl]hepta-1,3,5-trien-4-yl]-N-(4-methylphenyl)hydroxylamine (PubChem CID 143237401) has the molecular formula C27H28N2O and a molecular weight of 396.53 g/mol. Its IUPAC name is N-[(1E,3E,5Z)-1-[4-(4-methylanilino)phenyl]hepta-1,3,5-trien-4-yl]-N-(4-methylphenyl)hydroxylamine.
| Compound Name | N-[(1E,3E,5Z)-1-[4-(4-methylanilino)phenyl]hepta-1,3,5-trien-4-yl]-N-(4-methylphenyl)hydroxylamine |
|---|---|
| PubChem CID | 143237401 |
| Molecular Formula | C27H28N2O |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | N-[(1E,3E,5Z)-1-[4-(4-methylanilino)phenyl]hepta-1,3,5-trien-4-yl]-N-(4-methylphenyl)hydroxylamine |
| SMILES | C/C=C\C(=C/C=C/c1ccc(Nc2ccc(C)cc2)cc1)N(O)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H28N2O/c1-4-6-26(29(30)27-19-11-22(3)12-20-27)8-5-7-23-13-17-25(18-14-23)28-24-15-9-21(2)10-16-24/h4-20,28,30H,1-3H3/b6-4-,7-5+,26-8+ |
| InChIKey | CFJUKBNSKLYAMZ-GRBGYMRZSA-N |
| XLogP | 7.42 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|