C57H46N6 — CID 143239927
3-(4-aminophenyl)-5-[4-[6-[4-[3-(4-aminophenyl)-5-(methylamino)phenyl]phenyl]-2-[(3Z)-5-naphthalen-1-ylhexa-1,3,5-trien-2-yl]pyrimidin-4-yl]phenyl]aniline (PubChem CID 143239927) has the molecular formula C57H46N6 and a molecular weight of 815.04 g/mol. Its IUPAC name is 3-(4-aminophenyl)-5-[4-[6-[4-[3-(4-aminophenyl)-5-(methylamino)phenyl]phenyl]-2-[(3Z)-5-naphthalen-1-ylhexa-1,3,5-trien-2-yl]pyrimidin-4-yl]phenyl]aniline.
| Compound Name | 3-(4-aminophenyl)-5-[4-[6-[4-[3-(4-aminophenyl)-5-(methylamino)phenyl]phenyl]-2-[(3Z)-5-naphthalen-1-ylhexa-1,3,5-trien-2-yl]pyrimidin-4-yl]phenyl]aniline |
|---|---|
| PubChem CID | 143239927 |
| Molecular Formula | C57H46N6 |
| Molecular Weight | 815.04 g/mol |
| Exact Mass | 814.38 |
| IUPAC Name | 3-(4-aminophenyl)-5-[4-[6-[4-[3-(4-aminophenyl)-5-(methylamino)phenyl]phenyl]-2-[(3Z)-5-naphthalen-1-ylhexa-1,3,5-trien-2-yl]pyrimidin-4-yl]phenyl]aniline |
| SMILES | C=C(/C=C\C(=C)c1cccc2ccccc12)c1nc(-c2ccc(-c3cc(N)cc(-c4ccc(N)cc4)c3)cc2)cc(-c2ccc(-c3cc(NC)cc(-c4ccc(N)cc4)c3)cc2)n1 |
| InChI | InChI=1S/C57H46N6/c1-36(53-10-6-8-42-7-4-5-9-54(42)53)11-12-37(2)57-62-55(43-17-13-38(14-18-43)45-29-46(32-51(60)31-45)40-21-25-49(58)26-22-40)35-56(63-57)44-19-15-39(16-20-44)47-30-48(34-52(33-47)61-3)41-23-27-50(59)28-24-41/h4-35,61H,1-2,58-60H2,3H3/b12-11- |
| InChIKey | GQESKMOZRRHFOK-QXMHVHEDSA-N |
| XLogP | 13.70 |
| TPSA | 115.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.04 |
| LogP ≤ 5 | 13.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|