C31H24N2O4 — CID 143240634
methyl 3-[2-[5-(3,4-dimethoxyphenyl)-1-phenylpyrrolo[2,3-b]pyridin-3-yl]ethynyl]benzoate (PubChem CID 143240634) has the molecular formula C31H24N2O4 and a molecular weight of 488.54 g/mol. Its IUPAC name is methyl 3-[2-[5-(3,4-dimethoxyphenyl)-1-phenylpyrrolo[2,3-b]pyridin-3-yl]ethynyl]benzoate.
| Compound Name | methyl 3-[2-[5-(3,4-dimethoxyphenyl)-1-phenylpyrrolo[2,3-b]pyridin-3-yl]ethynyl]benzoate |
|---|---|
| PubChem CID | 143240634 |
| Molecular Formula | C31H24N2O4 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | methyl 3-[2-[5-(3,4-dimethoxyphenyl)-1-phenylpyrrolo[2,3-b]pyridin-3-yl]ethynyl]benzoate |
| SMILES | COC(=O)c1cccc(C#Cc2cn(-c3ccccc3)c3ncc(-c4ccc(OC)c(OC)c4)cc23)c1 |
| InChI | InChI=1S/C31H24N2O4/c1-35-28-15-14-22(18-29(28)36-2)25-17-27-24(13-12-21-8-7-9-23(16-21)31(34)37-3)20-33(30(27)32-19-25)26-10-5-4-6-11-26/h4-11,14-20H,1-3H3 |
| InChIKey | UNNVVQAGQKJVTC-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|