C14H19N3 — CID 143241239
5-ethyl-N-[(Z)-ethylideneamino]-N-[(1E)-2-methylbuta-1,3-dienyl]pyridin-2-amine (PubChem CID 143241239) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is 5-ethyl-N-[(Z)-ethylideneamino]-N-[(1E)-2-methylbuta-1,3-dienyl]pyridin-2-amine.
| Compound Name | 5-ethyl-N-[(Z)-ethylideneamino]-N-[(1E)-2-methylbuta-1,3-dienyl]pyridin-2-amine |
|---|---|
| PubChem CID | 143241239 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 5-ethyl-N-[(Z)-ethylideneamino]-N-[(1E)-2-methylbuta-1,3-dienyl]pyridin-2-amine |
| SMILES | C=C/C(C)=C/N(/N=C\C)c1ccc(CC)cn1 |
| InChI | InChI=1S/C14H19N3/c1-5-12(4)11-17(16-7-3)14-9-8-13(6-2)10-15-14/h5,7-11H,1,6H2,2-4H3/b12-11+,16-7- |
| InChIKey | GATAAOAJVWOJJO-NYEWPCBHSA-N |
| XLogP | 3.55 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|