C16H27N3 — CID 143067777
N-[(1E)-buta-1,3-dienyl]-5-ethyl-N-(methylideneamino)pyridin-2-amine;ethane (PubChem CID 143067777) has the molecular formula C16H27N3 and a molecular weight of 261.41 g/mol. Its IUPAC name is N-[(1E)-buta-1,3-dienyl]-5-ethyl-N-(methylideneamino)pyridin-2-amine;ethane.
| Compound Name | N-[(1E)-buta-1,3-dienyl]-5-ethyl-N-(methylideneamino)pyridin-2-amine;ethane |
|---|---|
| PubChem CID | 143067777 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | N-[(1E)-buta-1,3-dienyl]-5-ethyl-N-(methylideneamino)pyridin-2-amine;ethane |
| SMILES | C=C/C=C/N(N=C)c1ccc(CC)cn1.CC.CC |
| InChI | InChI=1S/C12H15N3.2C2H6/c1-4-6-9-15(13-3)12-8-7-11(5-2)10-14-12;2*1-2/h4,6-10H,1,3,5H2,2H3;2*1-2H3/b9-6+;; |
| InChIKey | WPDKWJVPIYJVFB-SWSRPJROSA-N |
| XLogP | 4.82 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|