C33H39N2O3S3+ — CID 143274059
methyl 3-[2-[(E)-2-[(E)-[3-ethyl-5-[(E)-2-phenylethenyl]-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]-4-methyl-5-[(Z)-prop-1-enyl]-1,3-thiazol-3-ium-3-yl]propane-1-sulfonate (PubChem CID 143274059) has the molecular formula C33H39N2O3S3+ and a molecular weight of 607.89 g/mol. Its IUPAC name is methyl 3-[2-[(E)-2-[(E)-[3-ethyl-5-[(E)-2-phenylethenyl]-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]-4-methyl-5-[(Z)-prop-1-enyl]-1,3-thiazol-3-ium-3-yl]propane-1-sulfonate.
| Compound Name | methyl 3-[2-[(E)-2-[(E)-[3-ethyl-5-[(E)-2-phenylethenyl]-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]-4-methyl-5-[(Z)-prop-1-enyl]-1,3-thiazol-3-ium-3-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 143274059 |
| Molecular Formula | C33H39N2O3S3+ |
| Molecular Weight | 607.89 g/mol |
| Exact Mass | 607.21 |
| IUPAC Name | methyl 3-[2-[(E)-2-[(E)-[3-ethyl-5-[(E)-2-phenylethenyl]-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]-4-methyl-5-[(Z)-prop-1-enyl]-1,3-thiazol-3-ium-3-yl]propane-1-sulfonate |
| SMILES | C/C=C\c1sc(/C=C(/C=C2/Sc3ccc(/C=C/c4ccccc4)cc3N2CC)CC)[n+](CCCS(=O)(=O)OC)c1C |
| InChI | InChI=1S/C33H39N2O3S3/c1-6-13-30-25(4)35(20-12-21-41(36,37)38-5)33(39-30)24-26(7-2)23-32-34(8-3)29-22-28(18-19-31(29)40-32)17-16-27-14-10-9-11-15-27/h6,9-11,13-19,22-24H,7-8,12,20-21H2,1-5H3/q+1/b13-6-,17-16+ |
| InChIKey | MHAHOANJSKQSKG-QAVTVINQSA-N |
| XLogP | 8.18 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.89 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|