C24H27N3O4S2 — CID 143287253
ethyl (Z,2Z)-4-amino-6-(5-buta-1,3-dien-2-yl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-2-ethylidene-3-methyl-5-oxohex-3-enoate (PubChem CID 143287253) has the molecular formula C24H27N3O4S2 and a molecular weight of 485.63 g/mol. Its IUPAC name is ethyl (Z,2Z)-4-amino-6-(5-buta-1,3-dien-2-yl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-2-ethylidene-3-methyl-5-oxohex-3-enoate.
| Compound Name | ethyl (Z,2Z)-4-amino-6-(5-buta-1,3-dien-2-yl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-2-ethylidene-3-methyl-5-oxohex-3-enoate |
|---|---|
| PubChem CID | 143287253 |
| Molecular Formula | C24H27N3O4S2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | ethyl (Z,2Z)-4-amino-6-(5-buta-1,3-dien-2-yl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-2-ethylidene-3-methyl-5-oxohex-3-enoate |
| SMILES | C=CCn1c(SCC(=O)/C(N)=C(C)/C(=C/C)C(=O)OCC)nc2scc(C(=C)C=C)c2c1=O |
| InChI | InChI=1S/C24H27N3O4S2/c1-7-11-27-22(29)19-17(14(5)8-2)12-32-21(19)26-24(27)33-13-18(28)20(25)15(6)16(9-3)23(30)31-10-4/h7-9,12H,1-2,5,10-11,13,25H2,3-4,6H3/b16-9-,20-15- |
| InChIKey | HKROFJDUALKIRQ-ZWIBDYAQSA-N |
| XLogP | 4.25 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|