C30H40O7 — CID 14329730
(2S)-6-[5-(4-acetyl-3-hydroxy-2-propylphenoxy)pentoxy]-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid (PubChem CID 14329730) has the molecular formula C30H40O7 and a molecular weight of 512.64 g/mol. Its IUPAC name is (2S)-6-[5-(4-acetyl-3-hydroxy-2-propylphenoxy)pentoxy]-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid.
| Compound Name | (2S)-6-[5-(4-acetyl-3-hydroxy-2-propylphenoxy)pentoxy]-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid |
|---|---|
| PubChem CID | 14329730 |
| Molecular Formula | C30H40O7 |
| Molecular Weight | 512.64 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | (2S)-6-[5-(4-acetyl-3-hydroxy-2-propylphenoxy)pentoxy]-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid |
| SMILES | CCCc1c(OCCCCCOc2c(C)c(C)c3c(c2C)CC[C@@](C)(C(=O)O)O3)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C30H40O7/c1-7-11-24-25(13-12-23(21(5)31)26(24)32)35-16-9-8-10-17-36-27-18(2)19(3)28-22(20(27)4)14-15-30(6,37-28)29(33)34/h12-13,32H,7-11,14-17H2,1-6H3,(H,33,34)/t30-/m0/s1 |
| InChIKey | NWHKTKOWRVDDIP-PMERELPUSA-N |
| XLogP | 6.27 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.64 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|