C11H22N2O — CID 143332794
N,N,2-trimethyl-6-(2-methyliminoethyl)oxan-4-amine (PubChem CID 143332794) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is N,N,2-trimethyl-6-(2-methyliminoethyl)oxan-4-amine.
| Compound Name | N,N,2-trimethyl-6-(2-methyliminoethyl)oxan-4-amine |
|---|---|
| PubChem CID | 143332794 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | N,N,2-trimethyl-6-(2-methyliminoethyl)oxan-4-amine |
| SMILES | C/N=C/CC1CC(N(C)C)CC(C)O1 |
| InChI | InChI=1S/C11H22N2O/c1-9-7-10(13(3)4)8-11(14-9)5-6-12-2/h6,9-11H,5,7-8H2,1-4H3/b12-6+ |
| InChIKey | ZDAFIFUFDBQTSM-WUXMJOGZSA-N |
| XLogP | 1.57 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|