C6H9IN2O2 — CID 143335302
6-iodo-6-methyl-1,3-diazepane-2,4-dione (PubChem CID 143335302) has the molecular formula C6H9IN2O2 and a molecular weight of 268.05 g/mol. Its IUPAC name is 6-iodo-6-methyl-1,3-diazepane-2,4-dione.
| Compound Name | 6-iodo-6-methyl-1,3-diazepane-2,4-dione |
|---|---|
| PubChem CID | 143335302 |
| Molecular Formula | C6H9IN2O2 |
| Molecular Weight | 268.05 g/mol |
| Exact Mass | 267.97 |
| IUPAC Name | 6-iodo-6-methyl-1,3-diazepane-2,4-dione |
| SMILES | CC1(I)CNC(=O)NC(=O)C1 |
| InChI | InChI=1S/C6H9IN2O2/c1-6(7)2-4(10)9-5(11)8-3-6/h2-3H2,1H3,(H2,8,9,10,11) |
| InChIKey | GFSRRSWEGYNGOI-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.05 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|