C24H37NO — CID 143339611
3-[4-(2-butylphenyl)phenyl]-2-(methylamino)propanal;ethane (PubChem CID 143339611) has the molecular formula C24H37NO and a molecular weight of 355.57 g/mol. Its IUPAC name is 3-[4-(2-butylphenyl)phenyl]-2-(methylamino)propanal;ethane.
| Compound Name | 3-[4-(2-butylphenyl)phenyl]-2-(methylamino)propanal;ethane |
|---|---|
| PubChem CID | 143339611 |
| Molecular Formula | C24H37NO |
| Molecular Weight | 355.57 g/mol |
| Exact Mass | 355.29 |
| IUPAC Name | 3-[4-(2-butylphenyl)phenyl]-2-(methylamino)propanal;ethane |
| SMILES | CC.CC.CCCCc1ccccc1-c1ccc(CC(C=O)NC)cc1 |
| InChI | InChI=1S/C20H25NO.2C2H6/c1-3-4-7-17-8-5-6-9-20(17)18-12-10-16(11-13-18)14-19(15-22)21-2;2*1-2/h5-6,8-13,15,19,21H,3-4,7,14H2,1-2H3;2*1-2H3 |
| InChIKey | XMYQKOCSLZRFNC-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|