C22H34N4 — CID 143343394
2-N-[[(1E,4E)-4-(dimethylamino)-5-methylcycloocta-1,4,7-trien-1-yl]methyl]-3-ethenylimino-4-N,5-dimethylhexa-1,4-diene-2,4-diamine (PubChem CID 143343394) has the molecular formula C22H34N4 and a molecular weight of 354.54 g/mol. Its IUPAC name is 2-N-[[(1E,4E)-4-(dimethylamino)-5-methylcycloocta-1,4,7-trien-1-yl]methyl]-3-ethenylimino-4-N,5-dimethylhexa-1,4-diene-2,4-diamine.
| Compound Name | 2-N-[[(1E,4E)-4-(dimethylamino)-5-methylcycloocta-1,4,7-trien-1-yl]methyl]-3-ethenylimino-4-N,5-dimethylhexa-1,4-diene-2,4-diamine |
|---|---|
| PubChem CID | 143343394 |
| Molecular Formula | C22H34N4 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | 2-N-[[(1E,4E)-4-(dimethylamino)-5-methylcycloocta-1,4,7-trien-1-yl]methyl]-3-ethenylimino-4-N,5-dimethylhexa-1,4-diene-2,4-diamine |
| SMILES | C=C/N=C(/C(=C)NC/C1=C/C/C(N(C)C)=C(/C)CC=C1)C(NC)=C(C)C |
| InChI | InChI=1S/C22H34N4/c1-9-24-22(21(23-6)16(2)3)18(5)25-15-19-12-10-11-17(4)20(14-13-19)26(7)8/h9-10,12-13,23,25H,1,5,11,14-15H2,2-4,6-8H3/b12-10?,19-13+,20-17+,24-22- |
| InChIKey | FLXZIHODCCJRRE-LRDIYMIWSA-N |
| XLogP | 4.30 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|