C27H42N6O2S — CID 143383830
ethane;1-[4-(3-methoxy-4-methylphenyl)piperazin-1-yl]-2-[(methylideneamino)methyl-[(E)-1-(1,3-thiazol-2-yl)but-3-enylideneamino]amino]ethanone (PubChem CID 143383830) has the molecular formula C27H42N6O2S and a molecular weight of 514.74 g/mol. Its IUPAC name is ethane;1-[4-(3-methoxy-4-methylphenyl)piperazin-1-yl]-2-[(methylideneamino)methyl-[(E)-1-(1,3-thiazol-2-yl)but-3-enylideneamino]amino]ethanone.
| Compound Name | ethane;1-[4-(3-methoxy-4-methylphenyl)piperazin-1-yl]-2-[(methylideneamino)methyl-[(E)-1-(1,3-thiazol-2-yl)but-3-enylideneamino]amino]ethanone |
|---|---|
| PubChem CID | 143383830 |
| Molecular Formula | C27H42N6O2S |
| Molecular Weight | 514.74 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | ethane;1-[4-(3-methoxy-4-methylphenyl)piperazin-1-yl]-2-[(methylideneamino)methyl-[(E)-1-(1,3-thiazol-2-yl)but-3-enylideneamino]amino]ethanone |
| SMILES | C=CC/C(=N\N(CN=C)CC(=O)N1CCN(c2ccc(C)c(OC)c2)CC1)c1nccs1.CC.CC |
| InChI | InChI=1S/C23H30N6O2S.2C2H6/c1-5-6-20(23-25-9-14-32-23)26-29(17-24-3)16-22(30)28-12-10-27(11-13-28)19-8-7-18(2)21(15-19)31-4;2*1-2/h5,7-9,14-15H,1,3,6,10-13,16-17H2,2,4H3;2*1-2H3/b26-20+;; |
| InChIKey | SXIVSBAADKIVCR-YZGCLRGYSA-N |
| XLogP | 5.10 |
| TPSA | 73.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.74 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|