C20H18F3N5O4 — CID 143411593
(1R,3R,7S)-6-(6-aminopurin-9-yl)-7-methyl-9-[4-(trifluoromethyl)phenyl]-4,8,10-trioxatricyclo[5.3.0.01,3]decan-2-ol (PubChem CID 143411593) has the molecular formula C20H18F3N5O4 and a molecular weight of 449.39 g/mol. Its IUPAC name is (1R,3R,7S)-6-(6-aminopurin-9-yl)-7-methyl-9-[4-(trifluoromethyl)phenyl]-4,8,10-trioxatricyclo[5.3.0.01,3]decan-2-ol.
| Compound Name | (1R,3R,7S)-6-(6-aminopurin-9-yl)-7-methyl-9-[4-(trifluoromethyl)phenyl]-4,8,10-trioxatricyclo[5.3.0.01,3]decan-2-ol |
|---|---|
| PubChem CID | 143411593 |
| Molecular Formula | C20H18F3N5O4 |
| Molecular Weight | 449.39 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | (1R,3R,7S)-6-(6-aminopurin-9-yl)-7-methyl-9-[4-(trifluoromethyl)phenyl]-4,8,10-trioxatricyclo[5.3.0.01,3]decan-2-ol |
| SMILES | C[C@@]12OC(c3ccc(C(F)(F)F)cc3)O[C@@]13C(O)[C@H]3OCC2n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C20H18F3N5O4/c1-18-11(28-8-27-12-15(24)25-7-26-16(12)28)6-30-14-13(29)19(14,18)32-17(31-18)9-2-4-10(5-3-9)20(21,22)23/h2-5,7-8,11,13-14,17,29H,6H2,1H3,(H2,24,25,26)/t11?,13?,14-,17?,18+,19-/m1/s1 |
| InChIKey | WEZYGSBZCWNRGB-AYFLOFSXSA-N |
| XLogP | 1.98 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |