C17H16ClN5O3 — CID 71216716
9-[(3aR,4R,6aR)-2-(4-chlorophenyl)-3a-methyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl]purin-6-amine (PubChem CID 71216716) has the molecular formula C17H16ClN5O3 and a molecular weight of 373.80 g/mol. Its IUPAC name is 9-[(3aR,4R,6aR)-2-(4-chlorophenyl)-3a-methyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl]purin-6-amine.
| Compound Name | 9-[(3aR,4R,6aR)-2-(4-chlorophenyl)-3a-methyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl]purin-6-amine |
|---|---|
| PubChem CID | 71216716 |
| Molecular Formula | C17H16ClN5O3 |
| Molecular Weight | 373.80 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 9-[(3aR,4R,6aR)-2-(4-chlorophenyl)-3a-methyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl]purin-6-amine |
| SMILES | C[C@@]12OC(c3ccc(Cl)cc3)O[C@@H]1CO[C@H]2n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C17H16ClN5O3/c1-17-11(25-15(26-17)9-2-4-10(18)5-3-9)6-24-16(17)23-8-22-12-13(19)20-7-21-14(12)23/h2-5,7-8,11,15-16H,6H2,1H3,(H2,19,20,21)/t11-,15?,16-,17-/m1/s1 |
| InChIKey | CPXNIVJRHFHREE-WXOYHSRTSA-N |
| XLogP | 2.46 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.80 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |