C21H38N2O6 — CID 143417697
N-amino-N-[(7R,9R,10R,11R)-3-hydroxy-9-methoxy-5,7,9,10,11,13-hexamethyl-6,12-dioxo-oxacyclotetradec-4-yl]formamide (PubChem CID 143417697) has the molecular formula C21H38N2O6 and a molecular weight of 414.54 g/mol. Its IUPAC name is N-amino-N-[(7R,9R,10R,11R)-3-hydroxy-9-methoxy-5,7,9,10,11,13-hexamethyl-6,12-dioxo-oxacyclotetradec-4-yl]formamide.
| Compound Name | N-amino-N-[(7R,9R,10R,11R)-3-hydroxy-9-methoxy-5,7,9,10,11,13-hexamethyl-6,12-dioxo-oxacyclotetradec-4-yl]formamide |
|---|---|
| PubChem CID | 143417697 |
| Molecular Formula | C21H38N2O6 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | N-amino-N-[(7R,9R,10R,11R)-3-hydroxy-9-methoxy-5,7,9,10,11,13-hexamethyl-6,12-dioxo-oxacyclotetradec-4-yl]formamide |
| SMILES | CO[C@]1(C)C[C@@H](C)C(=O)C(C)C(N(N)C=O)C(O)COCC(C)C(=O)[C@H](C)[C@H]1C |
| InChI | InChI=1S/C21H38N2O6/c1-12-8-21(6,28-7)16(5)14(3)20(27)13(2)9-29-10-17(25)18(23(22)11-24)15(4)19(12)26/h11-18,25H,8-10,22H2,1-7H3/t12-,13?,14-,15?,16-,17?,18?,21-/m1/s1 |
| InChIKey | NGMTWPDWOFLPOU-MPNYJXDUSA-N |
| XLogP | 1.19 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|