C20H26O2 — CID 143424041
[(3E,4Z)-3-ethylidene-2-methylhepta-4,6-dien-2-yl] (2E,4E,6Z)-4-ethenylocta-2,4,6-trienoate (PubChem CID 143424041) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is [(3E,4Z)-3-ethylidene-2-methylhepta-4,6-dien-2-yl] (2E,4E,6Z)-4-ethenylocta-2,4,6-trienoate.
| Compound Name | [(3E,4Z)-3-ethylidene-2-methylhepta-4,6-dien-2-yl] (2E,4E,6Z)-4-ethenylocta-2,4,6-trienoate |
|---|---|
| PubChem CID | 143424041 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | [(3E,4Z)-3-ethylidene-2-methylhepta-4,6-dien-2-yl] (2E,4E,6Z)-4-ethenylocta-2,4,6-trienoate |
| SMILES | C=C/C=C\C(=C/C)C(C)(C)OC(=O)/C=C/C(C=C)=C/C=C\C |
| InChI | InChI=1S/C20H26O2/c1-7-11-13-17(9-3)15-16-19(21)22-20(5,6)18(10-4)14-12-8-2/h7-16H,2-3H2,1,4-6H3/b11-7-,14-12-,16-15+,17-13+,18-10+ |
| InChIKey | RBZWHTOMRCDTSY-BXJPVFDPSA-N |
| XLogP | 5.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|