About acetylene;3-methylaniline;2-methylcyclohexan-1-amine
acetylene;3-methylaniline;2-methylcyclohexan-1-amine (PubChem CID 143436771) has the molecular formula C16H26N2
and a molecular weight of 246.40 g/mol. Its IUPAC name is acetylene;3-methylaniline;2-methylcyclohexan-1-amine.
Molecular Properties
| Compound Name | acetylene;3-methylaniline;2-methylcyclohexan-1-amine |
| PubChem CID | 143436771 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | acetylene;3-methylaniline;2-methylcyclohexan-1-amine |
| SMILES | C#C.CC1CCCCC1N.Cc1cccc(N)c1 |
| InChI | InChI=1S/C7H9N.C7H15N.C2H2/c1-6-3-2-4-7(8)5-6;1-6-4-2-3-5-7(6)8;1-2/h2-5H,8H2,1H3;6-7H,2-5,8H2,1H3;1-2H |
| InChIKey | XVVWXQIUNCTWRH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;3-methylaniline;2-methylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;3-methylaniline;2-methylcyclohexan-1-amine?
The IUPAC name of acetylene;3-methylaniline;2-methylcyclohexan-1-amine (CID 143436771) is acetylene;3-methylaniline;2-methylcyclohexan-1-amine.
What is the SMILES notation for acetylene;3-methylaniline;2-methylcyclohexan-1-amine?
The canonical SMILES for acetylene;3-methylaniline;2-methylcyclohexan-1-amine is C#C.CC1CCCCC1N.Cc1cccc(N)c1.
What is the InChIKey of acetylene;3-methylaniline;2-methylcyclohexan-1-amine?
The InChIKey is XVVWXQIUNCTWRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.C7H15N.C2H2/c1-6-3-2-4-7(8)5-6;1-6-4-2-3-5-7(6)8;1-2/h2-5H,8H2,1H3;6-7H,2-5,8H2,1H3;1-2H.
What are the key properties of acetylene;3-methylaniline;2-methylcyclohexan-1-amine?
acetylene;3-methylaniline;2-methylcyclohexan-1-amine has a molecular weight of 246.40 g/mol, XLogP of 3.35, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;3-methylaniline;2-methylcyclohexan-1-amine is sourced from PubChem (CID 143436771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).