C13H17F2N3O — CID 143448569
(E)-N-[(2,4-difluorophenyl)methyl]-3-(2-ethyl-2-methylhydrazinyl)prop-2-enamide (PubChem CID 143448569) has the molecular formula C13H17F2N3O and a molecular weight of 269.30 g/mol. Its IUPAC name is (E)-N-[(2,4-difluorophenyl)methyl]-3-(2-ethyl-2-methylhydrazinyl)prop-2-enamide.
| Compound Name | (E)-N-[(2,4-difluorophenyl)methyl]-3-(2-ethyl-2-methylhydrazinyl)prop-2-enamide |
|---|---|
| PubChem CID | 143448569 |
| Molecular Formula | C13H17F2N3O |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | (E)-N-[(2,4-difluorophenyl)methyl]-3-(2-ethyl-2-methylhydrazinyl)prop-2-enamide |
| SMILES | CCN(C)N/C=C/C(=O)NCc1ccc(F)cc1F |
| InChI | InChI=1S/C13H17F2N3O/c1-3-18(2)17-7-6-13(19)16-9-10-4-5-11(14)8-12(10)15/h4-8,17H,3,9H2,1-2H3,(H,16,19)/b7-6+ |
| InChIKey | OGYFZWOIJKSAAR-VOTSOKGWSA-N |
| XLogP | 1.55 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|