C39H62N6 — CID 143463837
4-N-[(2E,8Z)-6-ethyl-7-methyliminodeca-2,4,8-trienyl]-5-methyl-6-[(2E,4E,6E,8Z)-6-[(4-methylpiperazin-1-yl)methyl]deca-2,4,6,8-tetraenimidoyl]cyclohexa-1,5-diene-1,4-diamine;propane (PubChem CID 143463837) has the molecular formula C39H62N6 and a molecular weight of 614.97 g/mol. Its IUPAC name is 4-N-[(2E,8Z)-6-ethyl-7-methyliminodeca-2,4,8-trienyl]-5-methyl-6-[(2E,4E,6E,8Z)-6-[(4-methylpiperazin-1-yl)methyl]deca-2,4,6,8-tetraenimidoyl]cyclohexa-1,5-diene-1,4-diamine;propane.
| Compound Name | 4-N-[(2E,8Z)-6-ethyl-7-methyliminodeca-2,4,8-trienyl]-5-methyl-6-[(2E,4E,6E,8Z)-6-[(4-methylpiperazin-1-yl)methyl]deca-2,4,6,8-tetraenimidoyl]cyclohexa-1,5-diene-1,4-diamine;propane |
|---|---|
| PubChem CID | 143463837 |
| Molecular Formula | C39H62N6 |
| Molecular Weight | 614.97 g/mol |
| Exact Mass | 614.50 |
| IUPAC Name | 4-N-[(2E,8Z)-6-ethyl-7-methyliminodeca-2,4,8-trienyl]-5-methyl-6-[(2E,4E,6E,8Z)-6-[(4-methylpiperazin-1-yl)methyl]deca-2,4,6,8-tetraenimidoyl]cyclohexa-1,5-diene-1,4-diamine;propane |
| SMILES | CCC.[H]/N=C(\C=C\C=C\C(=C/C=C\C)CN1CCN(C)CC1)C1=C(C)C(NC/C=C/C=CC(CC)C(/C=C\C)=N/C)CC=C1N |
| InChI | InChI=1S/C36H54N6.C3H8/c1-7-10-17-30(28-42-26-24-41(6)25-27-42)18-13-14-20-32(37)36-29(4)34(22-21-33(36)38)40-23-15-11-12-19-31(9-3)35(39-5)16-8-2;1-3-2/h7-8,10-21,31,34,37,40H,9,22-28,38H2,1-6H3;3H2,1-2H3/b10-7-,15-11+,16-8-,18-13+,19-12?,20-14+,30-17+,37-32+,39-35+; |
| InChIKey | YLFJGNSAXBNHKN-COEXPTSVSA-N |
| XLogP | 7.59 |
| TPSA | 80.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.97 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|