C29H26F6N2O — CID 143473814
(E)-N-[2-phenyl-1-[3-(trifluoromethyl)phenyl]-1-[3-(trifluoromethyl)-2-pyridinyl]ethyl]-2-[(Z)-prop-1-enyl]pent-2-enamide (PubChem CID 143473814) has the molecular formula C29H26F6N2O and a molecular weight of 532.53 g/mol. Its IUPAC name is (E)-N-[2-phenyl-1-[3-(trifluoromethyl)phenyl]-1-[3-(trifluoromethyl)-2-pyridinyl]ethyl]-2-[(Z)-prop-1-enyl]pent-2-enamide.
| Compound Name | (E)-N-[2-phenyl-1-[3-(trifluoromethyl)phenyl]-1-[3-(trifluoromethyl)-2-pyridinyl]ethyl]-2-[(Z)-prop-1-enyl]pent-2-enamide |
|---|---|
| PubChem CID | 143473814 |
| Molecular Formula | C29H26F6N2O |
| Molecular Weight | 532.53 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | (E)-N-[2-phenyl-1-[3-(trifluoromethyl)phenyl]-1-[3-(trifluoromethyl)-2-pyridinyl]ethyl]-2-[(Z)-prop-1-enyl]pent-2-enamide |
| SMILES | C/C=C\C(=C/CC)C(=O)NC(Cc1ccccc1)(c1cccc(C(F)(F)F)c1)c1ncccc1C(F)(F)F |
| InChI | InChI=1S/C29H26F6N2O/c1-3-10-21(11-4-2)26(38)37-27(19-20-12-6-5-7-13-20,22-14-8-15-23(18-22)28(30,31)32)25-24(29(33,34)35)16-9-17-36-25/h3,5-18H,4,19H2,1-2H3,(H,37,38)/b10-3-,21-11+ |
| InChIKey | PRPCCOLRTBRMQC-NQNNKBIWSA-N |
| XLogP | 7.63 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.53 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|