C20H28O3 — CID 143474728
4-[1-[4-(2-methylbutyl)phenoxy]ethenyl]cyclohexane-1-carboxylic acid (PubChem CID 143474728) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is 4-[1-[4-(2-methylbutyl)phenoxy]ethenyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[1-[4-(2-methylbutyl)phenoxy]ethenyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 143474728 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 4-[1-[4-(2-methylbutyl)phenoxy]ethenyl]cyclohexane-1-carboxylic acid |
| SMILES | C=C(Oc1ccc(CC(C)CC)cc1)C1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C20H28O3/c1-4-14(2)13-16-5-11-19(12-6-16)23-15(3)17-7-9-18(10-8-17)20(21)22/h5-6,11-12,14,17-18H,3-4,7-10,13H2,1-2H3,(H,21,22) |
| InChIKey | NQRCDANMXMCYKY-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|