C13H6Cl3NO4S — CID 143476608
2,3-dihydroxy-5-(2,4,6-trichlorophenyl)sulfonylbenzonitrile (PubChem CID 143476608) has the molecular formula C13H6Cl3NO4S and a molecular weight of 378.62 g/mol. Its IUPAC name is 2,3-dihydroxy-5-(2,4,6-trichlorophenyl)sulfonylbenzonitrile.
| Compound Name | 2,3-dihydroxy-5-(2,4,6-trichlorophenyl)sulfonylbenzonitrile |
|---|---|
| PubChem CID | 143476608 |
| Molecular Formula | C13H6Cl3NO4S |
| Molecular Weight | 378.62 g/mol |
| Exact Mass | 376.91 |
| IUPAC Name | 2,3-dihydroxy-5-(2,4,6-trichlorophenyl)sulfonylbenzonitrile |
| SMILES | N#Cc1cc(S(=O)(=O)c2c(Cl)cc(Cl)cc2Cl)cc(O)c1O |
| InChI | InChI=1S/C13H6Cl3NO4S/c14-7-2-9(15)13(10(16)3-7)22(20,21)8-1-6(5-17)12(19)11(18)4-8/h1-4,18-19H |
| InChIKey | DTHSGAMZWHLPNV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.62 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|