About 3-chloro-2-hydroxy-5-[(2,4,6-trichlorophenoxy)methylamino]benzonitrile
3-chloro-2-hydroxy-5-[(2,4,6-trichlorophenoxy)methylamino]benzonitrile (PubChem CID 21045192) has the molecular formula C14H8Cl4N2O2
and a molecular weight of 378.04 g/mol. Its IUPAC name is 3-chloro-2-hydroxy-5-[(2,4,6-trichlorophenoxy)methylamino]benzonitrile.
Molecular Properties
| Compound Name | 3-chloro-2-hydroxy-5-[(2,4,6-trichlorophenoxy)methylamino]benzonitrile |
| PubChem CID | 21045192 |
| Molecular Formula | C14H8Cl4N2O2 |
| Molecular Weight | 378.04 g/mol |
| Exact Mass | 375.93 |
| IUPAC Name | 3-chloro-2-hydroxy-5-[(2,4,6-trichlorophenoxy)methylamino]benzonitrile |
| SMILES | N#Cc1cc(NCOc2c(Cl)cc(Cl)cc2Cl)cc(Cl)c1O |
| InChI | InChI=1S/C14H8Cl4N2O2/c15-8-2-11(17)14(12(18)3-8)22-6-20-9-1-7(5-19)13(21)10(16)4-9/h1-4,20-21H,6H2 |
| InChIKey | MXNPMPHSTVYEBT-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 65.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.04 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2-hydroxy-5-[(2,4,6-trichlorophenoxy)methylamino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-hydroxy-5-[(2,4,6-trichlorophenoxy)methylamino]benzonitrile?
The IUPAC name of 3-chloro-2-hydroxy-5-[(2,4,6-trichlorophenoxy)methylamino]benzonitrile (CID 21045192) is 3-chloro-2-hydroxy-5-[(2,4,6-trichlorophenoxy)methylamino]benzonitrile.
What is the SMILES notation for 3-chloro-2-hydroxy-5-[(2,4,6-trichlorophenoxy)methylamino]benzonitrile?
The canonical SMILES for 3-chloro-2-hydroxy-5-[(2,4,6-trichlorophenoxy)methylamino]benzonitrile is N#Cc1cc(NCOc2c(Cl)cc(Cl)cc2Cl)cc(Cl)c1O.
What is the InChIKey of 3-chloro-2-hydroxy-5-[(2,4,6-trichlorophenoxy)methylamino]benzonitrile?
The InChIKey is MXNPMPHSTVYEBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8Cl4N2O2/c15-8-2-11(17)14(12(18)3-8)22-6-20-9-1-7(5-19)13(21)10(16)4-9/h1-4,20-21H,6H2.
What are the key properties of 3-chloro-2-hydroxy-5-[(2,4,6-trichlorophenoxy)methylamino]benzonitrile?
3-chloro-2-hydroxy-5-[(2,4,6-trichlorophenoxy)methylamino]benzonitrile has a molecular weight of 378.04 g/mol, XLogP of 5.33, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-hydroxy-5-[(2,4,6-trichlorophenoxy)methylamino]benzonitrile is sourced from PubChem (CID 21045192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).