C13H17Cl2NO — CID 143506221
4-amino-4-(3,4-dichlorophenyl)heptanal (PubChem CID 143506221) has the molecular formula C13H17Cl2NO and a molecular weight of 274.19 g/mol. Its IUPAC name is 4-amino-4-(3,4-dichlorophenyl)heptanal.
| Compound Name | 4-amino-4-(3,4-dichlorophenyl)heptanal |
|---|---|
| PubChem CID | 143506221 |
| Molecular Formula | C13H17Cl2NO |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 4-amino-4-(3,4-dichlorophenyl)heptanal |
| SMILES | CCCC(N)(CCC=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H17Cl2NO/c1-2-6-13(16,7-3-8-17)10-4-5-11(14)12(15)9-10/h4-5,8-9H,2-3,6-7,16H2,1H3 |
| InChIKey | BCJPJFWCGYNKSE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|