C32H35N3O3 — CID 143506518
4-(8-benzyl-3,8-diazabicyclo[3.2.1]octan-3-yl)-2-[2-(3-ethyl-4-methoxyphenyl)ethyl]isoindole-1,3-dione (PubChem CID 143506518) has the molecular formula C32H35N3O3 and a molecular weight of 509.65 g/mol. Its IUPAC name is 4-(8-benzyl-3,8-diazabicyclo[3.2.1]octan-3-yl)-2-[2-(3-ethyl-4-methoxyphenyl)ethyl]isoindole-1,3-dione.
| Compound Name | 4-(8-benzyl-3,8-diazabicyclo[3.2.1]octan-3-yl)-2-[2-(3-ethyl-4-methoxyphenyl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 143506518 |
| Molecular Formula | C32H35N3O3 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.27 |
| IUPAC Name | 4-(8-benzyl-3,8-diazabicyclo[3.2.1]octan-3-yl)-2-[2-(3-ethyl-4-methoxyphenyl)ethyl]isoindole-1,3-dione |
| SMILES | CCc1cc(CCN2C(=O)c3cccc(N4CC5CCC(C4)N5Cc4ccccc4)c3C2=O)ccc1OC |
| InChI | InChI=1S/C32H35N3O3/c1-3-24-18-22(12-15-29(24)38-2)16-17-34-31(36)27-10-7-11-28(30(27)32(34)37)33-20-25-13-14-26(21-33)35(25)19-23-8-5-4-6-9-23/h4-12,15,18,25-26H,3,13-14,16-17,19-21H2,1-2H3 |
| InChIKey | WDKQVWNUQQVHBR-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|