C24H29N3O2S — CID 143508718
5-(1,3-benzodioxol-5-yl)-N-[3-[5-ethenyl-4-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]propyl]-1,3-thiazol-2-amine;ethane (PubChem CID 143508718) has the molecular formula C24H29N3O2S and a molecular weight of 423.58 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-N-[3-[5-ethenyl-4-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]propyl]-1,3-thiazol-2-amine;ethane.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-N-[3-[5-ethenyl-4-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]propyl]-1,3-thiazol-2-amine;ethane |
|---|---|
| PubChem CID | 143508718 |
| Molecular Formula | C24H29N3O2S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-N-[3-[5-ethenyl-4-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]propyl]-1,3-thiazol-2-amine;ethane |
| SMILES | C=Cc1[nH]cc(CCCNc2ncc(-c3ccc4c(c3)OCO4)s2)c1/C=C\C.CC |
| InChI | InChI=1S/C22H23N3O2S.C2H6/c1-3-6-17-16(12-24-18(17)4-2)7-5-10-23-22-25-13-21(28-22)15-8-9-19-20(11-15)27-14-26-19;1-2/h3-4,6,8-9,11-13,24H,2,5,7,10,14H2,1H3,(H,23,25);1-2H3/b6-3-; |
| InChIKey | AECGRXIMKPYIBJ-AQPBACSKSA-N |
| XLogP | 6.61 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|