About N-methylcyclohepta-1,6-diene-1-carboxamide;molecular hydrogen
N-methylcyclohepta-1,6-diene-1-carboxamide;molecular hydrogen (PubChem CID 143509672) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is N-methylcyclohepta-1,6-diene-1-carboxamide;molecular hydrogen.
Analyze N-methylcyclohepta-1,6-diene-1-carboxamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylcyclohepta-1,6-diene-1-carboxamide;molecular hydrogen?
The IUPAC name of N-methylcyclohepta-1,6-diene-1-carboxamide;molecular hydrogen (CID 143509672) is N-methylcyclohepta-1,6-diene-1-carboxamide;molecular hydrogen.
What is the SMILES notation for N-methylcyclohepta-1,6-diene-1-carboxamide;molecular hydrogen?
The canonical SMILES for N-methylcyclohepta-1,6-diene-1-carboxamide;molecular hydrogen is CNC(=O)C1=CCCCC=C1.[H][H].
What is the InChIKey of N-methylcyclohepta-1,6-diene-1-carboxamide;molecular hydrogen?
The InChIKey is FTADUSJBXZVYHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO.H2/c1-10-9(11)8-6-4-2-3-5-7-8;/h4,6-7H,2-3,5H2,1H3,(H,10,11);1H.
What are the key properties of N-methylcyclohepta-1,6-diene-1-carboxamide;molecular hydrogen?
N-methylcyclohepta-1,6-diene-1-carboxamide;molecular hydrogen has a molecular weight of 153.22 g/mol, XLogP of 1.64, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylcyclohepta-1,6-diene-1-carboxamide;molecular hydrogen is sourced from PubChem (CID 143509672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).