About N'-methoxybenzenecarboximidamide;3-methylbenzaldehyde
N'-methoxybenzenecarboximidamide;3-methylbenzaldehyde (PubChem CID 143517861) has the molecular formula C16H18N2O2
and a molecular weight of 270.33 g/mol. Its IUPAC name is N'-methoxybenzenecarboximidamide;3-methylbenzaldehyde.
Molecular Properties
| Compound Name | N'-methoxybenzenecarboximidamide;3-methylbenzaldehyde |
| PubChem CID | 143517861 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | N'-methoxybenzenecarboximidamide;3-methylbenzaldehyde |
| SMILES | CO/N=C(\N)c1ccccc1.Cc1cccc(C=O)c1 |
| InChI | InChI=1S/C8H10N2O.C8H8O/c1-11-10-8(9)7-5-3-2-4-6-7;1-7-3-2-4-8(5-7)6-9/h2-6H,1H3,(H2,9,10);2-6H,1H3 |
| InChIKey | SNTCGRGVHMCPKQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-methoxybenzenecarboximidamide;3-methylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methoxybenzenecarboximidamide;3-methylbenzaldehyde?
The IUPAC name of N'-methoxybenzenecarboximidamide;3-methylbenzaldehyde (CID 143517861) is N'-methoxybenzenecarboximidamide;3-methylbenzaldehyde.
What is the SMILES notation for N'-methoxybenzenecarboximidamide;3-methylbenzaldehyde?
The canonical SMILES for N'-methoxybenzenecarboximidamide;3-methylbenzaldehyde is CO/N=C(\N)c1ccccc1.Cc1cccc(C=O)c1.
What is the InChIKey of N'-methoxybenzenecarboximidamide;3-methylbenzaldehyde?
The InChIKey is SNTCGRGVHMCPKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O.C8H8O/c1-11-10-8(9)7-5-3-2-4-6-7;1-7-3-2-4-8(5-7)6-9/h2-6H,1H3,(H2,9,10);2-6H,1H3.
What are the key properties of N'-methoxybenzenecarboximidamide;3-methylbenzaldehyde?
N'-methoxybenzenecarboximidamide;3-methylbenzaldehyde has a molecular weight of 270.33 g/mol, XLogP of 2.76, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methoxybenzenecarboximidamide;3-methylbenzaldehyde is sourced from PubChem (CID 143517861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).