C17H25N2S+ — CID 143546831
4-[(1E,3E)-hexa-1,3,5-trienyl]-N,N-dimethylaniline;methylidene(2-sulfanylethyl)azanium (PubChem CID 143546831) has the molecular formula C17H25N2S+ and a molecular weight of 289.47 g/mol. Its IUPAC name is 4-[(1E,3E)-hexa-1,3,5-trienyl]-N,N-dimethylaniline;methylidene(2-sulfanylethyl)azanium.
| Compound Name | 4-[(1E,3E)-hexa-1,3,5-trienyl]-N,N-dimethylaniline;methylidene(2-sulfanylethyl)azanium |
|---|---|
| PubChem CID | 143546831 |
| Molecular Formula | C17H25N2S+ |
| Molecular Weight | 289.47 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 4-[(1E,3E)-hexa-1,3,5-trienyl]-N,N-dimethylaniline;methylidene(2-sulfanylethyl)azanium |
| SMILES | C=C/C=C/C=C/c1ccc(N(C)C)cc1.C=[NH+]CCS |
| InChI | InChI=1S/C14H17N.C3H7NS/c1-4-5-6-7-8-13-9-11-14(12-10-13)15(2)3;1-4-2-3-5/h4-12H,1H2,2-3H3;5H,1-3H2/p+1/b6-5+,8-7+; |
| InChIKey | KTCSLYYEIOPLID-YWEMJPMZSA-O |
| XLogP | 2.21 |
| TPSA | 17.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.47 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|