C20H21N7O — CID 143557436
N-[3-[2-amino-5-[(2-amino-1,3-diazabicyclo[4.1.0]hepta-2,4-dien-6-yl)amino]benzenecarboximidoyl]phenyl]acetamide (PubChem CID 143557436) has the molecular formula C20H21N7O and a molecular weight of 375.44 g/mol. Its IUPAC name is N-[3-[2-amino-5-[(2-amino-1,3-diazabicyclo[4.1.0]hepta-2,4-dien-6-yl)amino]benzenecarboximidoyl]phenyl]acetamide.
| Compound Name | N-[3-[2-amino-5-[(2-amino-1,3-diazabicyclo[4.1.0]hepta-2,4-dien-6-yl)amino]benzenecarboximidoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 143557436 |
| Molecular Formula | C20H21N7O |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | N-[3-[2-amino-5-[(2-amino-1,3-diazabicyclo[4.1.0]hepta-2,4-dien-6-yl)amino]benzenecarboximidoyl]phenyl]acetamide |
| SMILES | [H]/N=C(\c1cccc(NC(C)=O)c1)c1cc(NC23C=CN=C(N)N2C3)ccc1N |
| InChI | InChI=1S/C20H21N7O/c1-12(28)25-14-4-2-3-13(9-14)18(22)16-10-15(5-6-17(16)21)26-20-7-8-24-19(23)27(20)11-20/h2-10,22,26H,11,21H2,1H3,(H2,23,24)(H,25,28)/b22-18+ |
| InChIKey | RUQDYDDSJAQXFP-RELWKKBWSA-N |
| XLogP | 1.91 |
| TPSA | 132.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|