C26H19N5S — CID 143568429
2-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-imino-2-phenylethanimidamide (PubChem CID 143568429) has the molecular formula C26H19N5S and a molecular weight of 433.54 g/mol. Its IUPAC name is 2-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-imino-2-phenylethanimidamide.
| Compound Name | 2-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-imino-2-phenylethanimidamide |
|---|---|
| PubChem CID | 143568429 |
| Molecular Formula | C26H19N5S |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 2-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-imino-2-phenylethanimidamide |
| SMILES | [H]/N=C(\N=N\[H])C(Sc1nc(-c2ccccc2)cc(-c2ccccc2)c1C#N)c1ccccc1 |
| InChI | InChI=1S/C26H19N5S/c27-17-22-21(18-10-4-1-5-11-18)16-23(19-12-6-2-7-13-19)30-26(22)32-24(25(28)31-29)20-14-8-3-9-15-20/h1-16,24,28-29H/b28-25-,31-29+ |
| InChIKey | CVMIEDCPNFARBV-QGORGSHDSA-N |
| XLogP | 7.13 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|