C10H9F — CID 143576825
1-ethynyl-6-fluoro-3-methylcyclohepta-1,3,5-triene (PubChem CID 143576825) has the molecular formula C10H9F and a molecular weight of 148.18 g/mol. Its IUPAC name is 1-ethynyl-6-fluoro-3-methylcyclohepta-1,3,5-triene.
| Compound Name | 1-ethynyl-6-fluoro-3-methylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 143576825 |
| Molecular Formula | C10H9F |
| Molecular Weight | 148.18 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 1-ethynyl-6-fluoro-3-methylcyclohepta-1,3,5-triene |
| SMILES | C#CC1=CC(C)=CC=C(F)C1 |
| InChI | InChI=1S/C10H9F/c1-3-9-6-8(2)4-5-10(11)7-9/h1,4-6H,7H2,2H3 |
| InChIKey | GWUCTIMQBDWRTL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.18 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|