C13H8N2O3 — CID 14357762
3-methyl-1-oxidopyrido[3,2-g]quinolin-1-ium-5,10-dione (PubChem CID 14357762) has the molecular formula C13H8N2O3 and a molecular weight of 240.22 g/mol. Its IUPAC name is 3-methyl-1-oxidopyrido[3,2-g]quinolin-1-ium-5,10-dione.
| Compound Name | 3-methyl-1-oxidopyrido[3,2-g]quinolin-1-ium-5,10-dione |
|---|---|
| PubChem CID | 14357762 |
| Molecular Formula | C13H8N2O3 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 3-methyl-1-oxidopyrido[3,2-g]quinolin-1-ium-5,10-dione |
| SMILES | Cc1cc2c([n+]([O-])c1)C(=O)c1ncccc1C2=O |
| InChI | InChI=1S/C13H8N2O3/c1-7-5-9-11(15(18)6-7)13(17)10-8(12(9)16)3-2-4-14-10/h2-6H,1H3 |
| InChIKey | RJWFJENPRBVKIV-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 73.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|