C21H28O3 — CID 143601264
(4E)-5-ethoxy-4-[(Z)-3-[(5-methylcyclohepta-1,3,5-trien-1-yl)methoxy]prop-1-enyl]hepta-4,6-dienal (PubChem CID 143601264) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is (4E)-5-ethoxy-4-[(Z)-3-[(5-methylcyclohepta-1,3,5-trien-1-yl)methoxy]prop-1-enyl]hepta-4,6-dienal.
| Compound Name | (4E)-5-ethoxy-4-[(Z)-3-[(5-methylcyclohepta-1,3,5-trien-1-yl)methoxy]prop-1-enyl]hepta-4,6-dienal |
|---|---|
| PubChem CID | 143601264 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (4E)-5-ethoxy-4-[(Z)-3-[(5-methylcyclohepta-1,3,5-trien-1-yl)methoxy]prop-1-enyl]hepta-4,6-dienal |
| SMILES | C=C/C(OCC)=C(\C=C/COCC1=CC=CC(C)=CC1)CCC=O |
| InChI | InChI=1S/C21H28O3/c1-4-21(24-5-2)20(11-7-15-22)12-8-16-23-17-19-10-6-9-18(3)13-14-19/h4,6,8-10,12-13,15H,1,5,7,11,14,16-17H2,2-3H3/b12-8-,21-20+ |
| InChIKey | DTCMNFFMCSTIMY-ZKAWPWJCSA-N |
| XLogP | 4.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|