C19H30BNO4 — CID 143635290
(Z)-but-2-ene;3-(dimethylamino)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (PubChem CID 143635290) has the molecular formula C19H30BNO4 and a molecular weight of 347.26 g/mol. Its IUPAC name is (Z)-but-2-ene;3-(dimethylamino)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid.
| Compound Name | (Z)-but-2-ene;3-(dimethylamino)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
|---|---|
| PubChem CID | 143635290 |
| Molecular Formula | C19H30BNO4 |
| Molecular Weight | 347.26 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | (Z)-but-2-ene;3-(dimethylamino)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| SMILES | C/C=C\C.CN(C)c1cc(B2OC(C)(C)C(C)(C)O2)cc(C(=O)O)c1 |
| InChI | InChI=1S/C15H22BNO4.C4H8/c1-14(2)15(3,4)21-16(20-14)11-7-10(13(18)19)8-12(9-11)17(5)6;1-3-4-2/h7-9H,1-6H3,(H,18,19);3-4H,1-2H3/b;4-3- |
| InChIKey | UTZBXQCKMNEDPI-QGAMPUOQSA-N |
| XLogP | 3.33 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.26 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|