C26H32B2F2O6 — CID 172776305
3-[[2,4-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (PubChem CID 172776305) has the molecular formula C26H32B2F2O6 and a molecular weight of 500.16 g/mol. Its IUPAC name is 3-[[2,4-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid.
| Compound Name | 3-[[2,4-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
|---|---|
| PubChem CID | 172776305 |
| Molecular Formula | C26H32B2F2O6 |
| Molecular Weight | 500.16 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | 3-[[2,4-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| SMILES | CC1(C)OB(c2cc(Cc3cc(B4OC(C)(C)C(C)(C)O4)c(F)cc3F)cc(C(=O)O)c2)OC1(C)C |
| InChI | InChI=1S/C26H32B2F2O6/c1-23(2)24(3,4)34-27(33-23)18-11-15(10-17(12-18)22(31)32)9-16-13-19(21(30)14-20(16)29)28-35-25(5,6)26(7,8)36-28/h10-14H,9H2,1-8H3,(H,31,32) |
| InChIKey | NQHKSAQTQBRQLO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.16 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|