C22H28 — CID 143675251
ethane;8-prop-1-en-2-yl-7-propyl-1,2-dihydrophenanthrene (PubChem CID 143675251) has the molecular formula C22H28 and a molecular weight of 292.47 g/mol. Its IUPAC name is ethane;8-prop-1-en-2-yl-7-propyl-1,2-dihydrophenanthrene.
| Compound Name | ethane;8-prop-1-en-2-yl-7-propyl-1,2-dihydrophenanthrene |
|---|---|
| PubChem CID | 143675251 |
| Molecular Formula | C22H28 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | ethane;8-prop-1-en-2-yl-7-propyl-1,2-dihydrophenanthrene |
| SMILES | C=C(C)c1c(CCC)ccc2c3c(ccc12)CCC=C3.CC |
| InChI | InChI=1S/C20H22.C2H6/c1-4-7-16-11-12-18-17-9-6-5-8-15(17)10-13-19(18)20(16)14(2)3;1-2/h6,9-13H,2,4-5,7-8H2,1,3H3;1-2H3 |
| InChIKey | CIYRODJZAOQUNJ-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |