C22H33N5O3 — CID 143700691
(E)-3-[2-[1-(benzylamino)propan-2-ylamino]-1,2,3,4-tetrahydropyrazin-5-yl]-N-(oxan-2-yloxy)prop-2-enamide (PubChem CID 143700691) has the molecular formula C22H33N5O3 and a molecular weight of 415.54 g/mol. Its IUPAC name is (E)-3-[2-[1-(benzylamino)propan-2-ylamino]-1,2,3,4-tetrahydropyrazin-5-yl]-N-(oxan-2-yloxy)prop-2-enamide.
| Compound Name | (E)-3-[2-[1-(benzylamino)propan-2-ylamino]-1,2,3,4-tetrahydropyrazin-5-yl]-N-(oxan-2-yloxy)prop-2-enamide |
|---|---|
| PubChem CID | 143700691 |
| Molecular Formula | C22H33N5O3 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | (E)-3-[2-[1-(benzylamino)propan-2-ylamino]-1,2,3,4-tetrahydropyrazin-5-yl]-N-(oxan-2-yloxy)prop-2-enamide |
| SMILES | CC(CNCc1ccccc1)NC1CNC(/C=C/C(=O)NOC2CCCCO2)=CN1 |
| InChI | InChI=1S/C22H33N5O3/c1-17(13-23-14-18-7-3-2-4-8-18)26-20-16-24-19(15-25-20)10-11-21(28)27-30-22-9-5-6-12-29-22/h2-4,7-8,10-11,15,17,20,22-26H,5-6,9,12-14,16H2,1H3,(H,27,28)/b11-10+ |
| InChIKey | HXGFSDKNJWACDO-ZHACJKMWSA-N |
| XLogP | 1.25 |
| TPSA | 95.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|