C25H38N6O4 — CID 143700633
(E)-3-[3-(4-amino-1-oxopentan-2-yl)imino-2,4-dihydro-1H-pyrazin-6-yl]-N-(oxan-2-yloxy)prop-2-enamide;N-methyl-1-phenylmethanamine (PubChem CID 143700633) has the molecular formula C25H38N6O4 and a molecular weight of 486.62 g/mol. Its IUPAC name is (E)-3-[3-(4-amino-1-oxopentan-2-yl)imino-2,4-dihydro-1H-pyrazin-6-yl]-N-(oxan-2-yloxy)prop-2-enamide;N-methyl-1-phenylmethanamine.
| Compound Name | (E)-3-[3-(4-amino-1-oxopentan-2-yl)imino-2,4-dihydro-1H-pyrazin-6-yl]-N-(oxan-2-yloxy)prop-2-enamide;N-methyl-1-phenylmethanamine |
|---|---|
| PubChem CID | 143700633 |
| Molecular Formula | C25H38N6O4 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | (E)-3-[3-(4-amino-1-oxopentan-2-yl)imino-2,4-dihydro-1H-pyrazin-6-yl]-N-(oxan-2-yloxy)prop-2-enamide;N-methyl-1-phenylmethanamine |
| SMILES | CC(N)CC(C=O)/N=C1\CNC(/C=C/C(=O)NOC2CCCCO2)=CN1.CNCc1ccccc1 |
| InChI | InChI=1S/C17H27N5O4.C8H11N/c1-12(18)8-14(11-23)21-15-10-19-13(9-20-15)5-6-16(24)22-26-17-4-2-3-7-25-17;1-9-7-8-5-3-2-4-6-8/h5-6,9,11-12,14,17,19H,2-4,7-8,10,18H2,1H3,(H,20,21)(H,22,24);2-6,9H,7H2,1H3/b6-5+; |
| InChIKey | UDPKVIGDKSDSMY-IPZCTEOASA-N |
| XLogP | 1.26 |
| TPSA | 139.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|