C24H31ClN4O — CID 143705954
4-amino-2-[4-(aminomethyl)cyclohexyl]-6-[(2E,4Z)-hepta-2,4,6-trien-3-yl]pyridazin-3-one;chlorobenzene (PubChem CID 143705954) has the molecular formula C24H31ClN4O and a molecular weight of 426.99 g/mol. Its IUPAC name is 4-amino-2-[4-(aminomethyl)cyclohexyl]-6-[(2E,4Z)-hepta-2,4,6-trien-3-yl]pyridazin-3-one;chlorobenzene.
| Compound Name | 4-amino-2-[4-(aminomethyl)cyclohexyl]-6-[(2E,4Z)-hepta-2,4,6-trien-3-yl]pyridazin-3-one;chlorobenzene |
|---|---|
| PubChem CID | 143705954 |
| Molecular Formula | C24H31ClN4O |
| Molecular Weight | 426.99 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 4-amino-2-[4-(aminomethyl)cyclohexyl]-6-[(2E,4Z)-hepta-2,4,6-trien-3-yl]pyridazin-3-one;chlorobenzene |
| SMILES | C=C/C=C\C(=C/C)c1cc(N)c(=O)n(C2CCC(CN)CC2)n1.Clc1ccccc1 |
| InChI | InChI=1S/C18H26N4O.C6H5Cl/c1-3-5-6-14(4-2)17-11-16(20)18(23)22(21-17)15-9-7-13(12-19)8-10-15;7-6-4-2-1-3-5-6/h3-6,11,13,15H,1,7-10,12,19-20H2,2H3;1-5H/b6-5-,14-4+; |
| InChIKey | VOMYSQDUUGBLDQ-NHRISWHCSA-N |
| XLogP | 5.00 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.99 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|