C9H11ClO3 — CID 143712862
2-chloro-4,5-dimethoxycyclohexa-1,5-diene-1-carbaldehyde (PubChem CID 143712862) has the molecular formula C9H11ClO3 and a molecular weight of 202.64 g/mol. Its IUPAC name is 2-chloro-4,5-dimethoxycyclohexa-1,5-diene-1-carbaldehyde.
| Compound Name | 2-chloro-4,5-dimethoxycyclohexa-1,5-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 143712862 |
| Molecular Formula | C9H11ClO3 |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 2-chloro-4,5-dimethoxycyclohexa-1,5-diene-1-carbaldehyde |
| SMILES | COC1=CC(C=O)=C(Cl)CC1OC |
| InChI | InChI=1S/C9H11ClO3/c1-12-8-3-6(5-11)7(10)4-9(8)13-2/h3,5,9H,4H2,1-2H3 |
| InChIKey | CCDSIBBSMQDLFE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|