C10H16O4 — CID 149114615
1,2,4,5-tetramethoxycyclohexa-1,3-diene (PubChem CID 149114615) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is 1,2,4,5-tetramethoxycyclohexa-1,3-diene.
| Compound Name | 1,2,4,5-tetramethoxycyclohexa-1,3-diene |
|---|---|
| PubChem CID | 149114615 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 1,2,4,5-tetramethoxycyclohexa-1,3-diene |
| SMILES | COC1=CC(OC)=C(OC)CC1OC |
| InChI | InChI=1S/C10H16O4/c1-11-7-5-9(13-3)10(14-4)6-8(7)12-2/h5,8H,6H2,1-4H3 |
| InChIKey | QYDAKWNQURCDMP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |