C12H14O5S — CID 22895825
2,4-dimethoxy-2,3-dihydronaphthalene-1-sulfonic acid (PubChem CID 22895825) has the molecular formula C12H14O5S and a molecular weight of 270.31 g/mol. Its IUPAC name is 2,4-dimethoxy-2,3-dihydronaphthalene-1-sulfonic acid.
| Compound Name | 2,4-dimethoxy-2,3-dihydronaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 22895825 |
| Molecular Formula | C12H14O5S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 2,4-dimethoxy-2,3-dihydronaphthalene-1-sulfonic acid |
| SMILES | COC1=c2ccccc2=C(S(=O)(=O)O)C(OC)C1 |
| InChI | InChI=1S/C12H14O5S/c1-16-10-7-11(17-2)12(18(13,14)15)9-6-4-3-5-8(9)10/h3-6,11H,7H2,1-2H3,(H,13,14,15) |
| InChIKey | GOJHSBPDERNEOW-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|