C10H10O5S — CID 87783626
5-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-sulfonic acid (PubChem CID 87783626) has the molecular formula C10H10O5S and a molecular weight of 242.25 g/mol. Its IUPAC name is 5-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-sulfonic acid.
| Compound Name | 5-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-sulfonic acid |
|---|---|
| PubChem CID | 87783626 |
| Molecular Formula | C10H10O5S |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | 5-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-sulfonic acid |
| SMILES | O=S(=O)(O)C1=COC(C2=CC=CCC2)=CO1 |
| InChI | InChI=1S/C10H10O5S/c11-16(12,13)10-7-14-9(6-15-10)8-4-2-1-3-5-8/h1-2,4,6-7H,3,5H2,(H,11,12,13) |
| InChIKey | DZNQCRRMNOYZBA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|