C23H23F4N3O3 — CID 143730947
7-[[amino-[(Z)-2-amino-3-hydroxy-3-(trifluoromethyl)hex-1-enyl]amino]methyl]-4-(3-fluorophenyl)chromen-2-one (PubChem CID 143730947) has the molecular formula C23H23F4N3O3 and a molecular weight of 465.45 g/mol. Its IUPAC name is 7-[[amino-[(Z)-2-amino-3-hydroxy-3-(trifluoromethyl)hex-1-enyl]amino]methyl]-4-(3-fluorophenyl)chromen-2-one.
| Compound Name | 7-[[amino-[(Z)-2-amino-3-hydroxy-3-(trifluoromethyl)hex-1-enyl]amino]methyl]-4-(3-fluorophenyl)chromen-2-one |
|---|---|
| PubChem CID | 143730947 |
| Molecular Formula | C23H23F4N3O3 |
| Molecular Weight | 465.45 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 7-[[amino-[(Z)-2-amino-3-hydroxy-3-(trifluoromethyl)hex-1-enyl]amino]methyl]-4-(3-fluorophenyl)chromen-2-one |
| SMILES | CCCC(O)(/C(N)=C/N(N)Cc1ccc2c(-c3cccc(F)c3)cc(=O)oc2c1)C(F)(F)F |
| InChI | InChI=1S/C23H23F4N3O3/c1-2-8-22(32,23(25,26)27)20(28)13-30(29)12-14-6-7-17-18(11-21(31)33-19(17)9-14)15-4-3-5-16(24)10-15/h3-7,9-11,13,32H,2,8,12,28-29H2,1H3/b20-13- |
| InChIKey | CJHHMGVONNFDDB-MOSHPQCFSA-N |
| XLogP | 4.17 |
| TPSA | 105.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|