C20H21F3N4O4 — CID 143730964
7-[[amino-[(Z)-2-amino-3-hydroxy-3-(trifluoromethyl)pent-1-enyl]amino]methyl]-4-(5-methyl-1,2-oxazol-3-yl)chromen-2-one (PubChem CID 143730964) has the molecular formula C20H21F3N4O4 and a molecular weight of 438.41 g/mol. Its IUPAC name is 7-[[amino-[(Z)-2-amino-3-hydroxy-3-(trifluoromethyl)pent-1-enyl]amino]methyl]-4-(5-methyl-1,2-oxazol-3-yl)chromen-2-one.
| Compound Name | 7-[[amino-[(Z)-2-amino-3-hydroxy-3-(trifluoromethyl)pent-1-enyl]amino]methyl]-4-(5-methyl-1,2-oxazol-3-yl)chromen-2-one |
|---|---|
| PubChem CID | 143730964 |
| Molecular Formula | C20H21F3N4O4 |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 7-[[amino-[(Z)-2-amino-3-hydroxy-3-(trifluoromethyl)pent-1-enyl]amino]methyl]-4-(5-methyl-1,2-oxazol-3-yl)chromen-2-one |
| SMILES | CCC(O)(/C(N)=C/N(N)Cc1ccc2c(-c3cc(C)on3)cc(=O)oc2c1)C(F)(F)F |
| InChI | InChI=1S/C20H21F3N4O4/c1-3-19(29,20(21,22)23)17(24)10-27(25)9-12-4-5-13-14(15-6-11(2)31-26-15)8-18(28)30-16(13)7-12/h4-8,10,29H,3,9,24-25H2,1-2H3/b17-10- |
| InChIKey | URPGNFSWOKTALB-YVLHZVERSA-N |
| XLogP | 2.94 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|